CAS 1185306-97-1 is the registry number for 2,6-Dichloropyridine-3,4,5-D3. Offered by: TRC. Available pack sizes: 50mg.
2,6-dichloro-3,4,5-trideuteriopyridine (CAS 1185306-97-1) is a chemical compound with the molecular formula C5H3Cl2N and a molecular weight of 151.01 g/mol. IUPAC name: 2,6-dichloro-3,4,5-trideuteriopyridine. InChIKey: FILKGCRCWDMBKA-CBYSEHNBSA-N.
| Molecular formula | C5H3Cl2N |
|---|---|
| Molecular weight | 151.01 g/mol |
| IUPAC name | 2,6-dichloro-3,4,5-trideuteriopyridine |
| InChIKey | FILKGCRCWDMBKA-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])Cl)Cl)[2H] |
Computed by PubChem (NCBI)