CAS 1185307-00-9 is the registry number for 4–Chloro–6–(n–propyl–d7)–pyrimidine. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
4-chloro-6-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyrimidine (CAS 1185307-00-9) is a chemical compound with the molecular formula C7H9ClN2 and a molecular weight of 163.65 g/mol. IUPAC name: 4-chloro-6-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyrimidine. InChIKey: PGPZIGLZSPQJBD-NCKGIQLSSA-N.
| Molecular formula | C7H9ClN2 |
|---|---|
| Molecular weight | 163.65 g/mol |
| IUPAC name | 4-chloro-6-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyrimidine |
| InChIKey | PGPZIGLZSPQJBD-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=CC(=NC=N1)Cl |
Computed by PubChem (NCBI)