CAS 1185307-07-6 is the registry number for 5–(methyl–d3)thiazol–2–amine. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
5-(trideuteriomethyl)-1,3-thiazol-2-amine (CAS 1185307-07-6) is a chemical compound with the molecular formula C4H6N2S and a molecular weight of 117.19 g/mol. IUPAC name: 5-(trideuteriomethyl)-1,3-thiazol-2-amine. InChIKey: GUABFMPMKJGSBQ-FIBGUPNXSA-N.
| Molecular formula | C4H6N2S |
|---|---|
| Molecular weight | 117.19 g/mol |
| IUPAC name | 5-(trideuteriomethyl)-1,3-thiazol-2-amine |
| InChIKey | GUABFMPMKJGSBQ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CN=C(S1)N |
Computed by PubChem (NCBI)