CAS 1185307-23-6 is the registry number for 6–chloropyridin–3,4,5–d3–2–amine. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
6-chloro-3,4,5-trideuteriopyridin-2-amine (CAS 1185307-23-6) is a chemical compound with the molecular formula C5H5ClN2 and a molecular weight of 131.58 g/mol. IUPAC name: 6-chloro-3,4,5-trideuteriopyridin-2-amine. InChIKey: OBYJTLDIQBWBHM-CBYSEHNBSA-N.
| Molecular formula | C5H5ClN2 |
|---|---|
| Molecular weight | 131.58 g/mol |
| IUPAC name | 6-chloro-3,4,5-trideuteriopyridin-2-amine |
| InChIKey | OBYJTLDIQBWBHM-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])Cl)N)[2H] |
Computed by PubChem (NCBI)