CAS 1185307-30-5 is the registry number for 2–Chloro–6–dimethylaminopyridine–d9. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
6-chloro-3,4,5-trideuterio-N,N-bis(trideuteriomethyl)pyridin-2-amine (CAS 1185307-30-5) is a chemical compound with the molecular formula C7H9ClN2 and a molecular weight of 165.67 g/mol. IUPAC name: 6-chloro-3,4,5-trideuterio-N,N-bis(trideuteriomethyl)pyridin-2-amine. InChIKey: AFMVRODDQDUXCX-XVGWXEQOSA-N.
| Molecular formula | C7H9ClN2 |
|---|---|
| Molecular weight | 165.67 g/mol |
| IUPAC name | 6-chloro-3,4,5-trideuterio-N,N-bis(trideuteriomethyl)pyridin-2-amine |
| InChIKey | AFMVRODDQDUXCX-XVGWXEQOSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])Cl)N(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)