CAS 1185307-50-9 is the registry number for 2–(iso–Propoxy–d7)bromobenzene. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
1-bromo-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)benzene (CAS 1185307-50-9) is a chemical compound with the molecular formula C9H11BrO and a molecular weight of 222.13 g/mol. IUPAC name: 1-bromo-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)benzene. InChIKey: MMORVPBHAHXAHH-QXMYYZBZSA-N.
| Molecular formula | C9H11BrO |
|---|---|
| Molecular weight | 222.13 g/mol |
| IUPAC name | 1-bromo-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)benzene |
| InChIKey | MMORVPBHAHXAHH-QXMYYZBZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])OC1=CC=CC=C1Br |
Computed by PubChem (NCBI)