Products 1185308-19-3
CAS 1185308-19-3 is the registry number for 4–Bromo–2–(methylamino–d3)–pyridine. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
4-bromo-N-(trideuteriomethyl)pyridin-2-amine (CAS 1185308-19-3) is a chemical compound with the molecular formula C6H7BrN2 and a molecular weight of 190.06 g/mol. IUPAC name: 4-bromo-N-(trideuteriomethyl)pyridin-2-amine. InChIKey: ZWIJDMCKZGENFF-FIBGUPNXSA-N.
| Molecular formula | C6H7BrN2 |
|---|---|
| Molecular weight | 190.06 g/mol |
| IUPAC name | 4-bromo-N-(trideuteriomethyl)pyridin-2-amine |
| InChIKey | ZWIJDMCKZGENFF-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC1=NC=CC(=C1)Br |
Computed by PubChem (NCBI)