CAS 1185308-86-4 is the registry number for 2–Amino–6–(n–propyl–d7)–pyridine. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
6-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyridin-2-amine (CAS 1185308-86-4) is a chemical compound with the molecular formula C8H12N2 and a molecular weight of 143.24 g/mol. IUPAC name: 6-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyridin-2-amine. InChIKey: JDRTXRTVJTWITJ-WUZWKBOJSA-N.
| Molecular formula | C8H12N2 |
|---|---|
| Molecular weight | 143.24 g/mol |
| IUPAC name | 6-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyridin-2-amine |
| InChIKey | JDRTXRTVJTWITJ-WUZWKBOJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=NC(=CC=C1)N |
Computed by PubChem (NCBI)