Products 1185309-02-7
CAS 1185309-02-7 is the registry number for 3–Fluoro–5–(methoxy–d3)–bromobenzene. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
1-bromo-3-fluoro-5-(trideuteriomethoxy)benzene (CAS 1185309-02-7) is a chemical compound with the molecular formula C7H6BrFO and a molecular weight of 208.04 g/mol. IUPAC name: 1-bromo-3-fluoro-5-(trideuteriomethoxy)benzene. InChIKey: XVNQVSGOIUYOPB-FIBGUPNXSA-N.
| Molecular formula | C7H6BrFO |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | 1-bromo-3-fluoro-5-(trideuteriomethoxy)benzene |
| InChIKey | XVNQVSGOIUYOPB-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=CC(=C1)Br)F |
Computed by PubChem (NCBI)