CAS 1185309-08-3 is the registry number for 3,5–(Dimethyl–d6)–fluorobenzene. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
1-fluoro-3,5-bis(trideuteriomethyl)benzene (CAS 1185309-08-3) is a chemical compound with the molecular formula C8H9F and a molecular weight of 130.19 g/mol. IUPAC name: 1-fluoro-3,5-bis(trideuteriomethyl)benzene. InChIKey: RCWIWNUVHNAUQC-WFGJKAKNSA-N.
| Molecular formula | C8H9F |
|---|---|
| Molecular weight | 130.19 g/mol |
| IUPAC name | 1-fluoro-3,5-bis(trideuteriomethyl)benzene |
| InChIKey | RCWIWNUVHNAUQC-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=CC(=C1)F)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)