CAS 1185309-13-0 is the registry number for 4–Chloro–6–methyl–2–(methyl–d3)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-chloro-6-methyl-2-(trideuteriomethyl)pyrimidine (CAS 1185309-13-0) is a chemical compound with the molecular formula C6H7ClN2 and a molecular weight of 145.60 g/mol. IUPAC name: 4-chloro-6-methyl-2-(trideuteriomethyl)pyrimidine. InChIKey: GSXFOGXQLRLSKK-BMSJAHLVSA-N.
| Molecular formula | C6H7ClN2 |
|---|---|
| Molecular weight | 145.60 g/mol |
| IUPAC name | 4-chloro-6-methyl-2-(trideuteriomethyl)pyrimidine |
| InChIKey | GSXFOGXQLRLSKK-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC(=CC(=N1)Cl)C |
Computed by PubChem (NCBI)