CAS 1185309-60-7 is the registry number for 2–Amino–4–(iso–propyl–d7)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrimidin-2-amine (CAS 1185309-60-7) is a chemical compound with the molecular formula C7H11N3 and a molecular weight of 144.23 g/mol. IUPAC name: 4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrimidin-2-amine. InChIKey: AVRNZAITOUMSPB-TXVPSQRDSA-N.
| Molecular formula | C7H11N3 |
|---|---|
| Molecular weight | 144.23 g/mol |
| IUPAC name | 4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrimidin-2-amine |
| InChIKey | AVRNZAITOUMSPB-TXVPSQRDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=NC(=NC=C1)N)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)