CAS 1185309-80-1 is the registry number for 3,4,5,6-Tetrahydro-2h-[1,2']bipyridinyl-3-ylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-pyridin-2-ylpiperidin-3-amine;hydrochloride (CAS 1185309-80-1) is a chemical compound with the molecular formula C10H16ClN3 and a molecular weight of 213.71 g/mol. IUPAC name: 1-pyridin-2-ylpiperidin-3-amine;hydrochloride. InChIKey: MYSDFLHWVMWWPI-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN3 |
|---|---|
| Molecular weight | 213.71 g/mol |
| IUPAC name | 1-pyridin-2-ylpiperidin-3-amine;hydrochloride |
| InChIKey | MYSDFLHWVMWWPI-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=CC=CC=N2)N.Cl |
Computed by PubChem (NCBI)