CAS 1185310-06-8 is the registry number for 4–Amino–3–(methoxy–d3)–bromobenzene. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-bromo-2-(trideuteriomethoxy)aniline (CAS 1185310-06-8) is a chemical compound with the molecular formula C7H8BrNO and a molecular weight of 205.07 g/mol. IUPAC name: 4-bromo-2-(trideuteriomethoxy)aniline. InChIKey: WRFYIYOXJWKONR-FIBGUPNXSA-N.
| Molecular formula | C7H8BrNO |
|---|---|
| Molecular weight | 205.07 g/mol |
| IUPAC name | 4-bromo-2-(trideuteriomethoxy)aniline |
| InChIKey | WRFYIYOXJWKONR-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)Br)N |
Computed by PubChem (NCBI)