CAS 1185310-14-8 is the registry number for 2–(Methyl–d3)–5–fluorochlorobenzene. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
2-chloro-4-fluoro-1-(trideuteriomethyl)benzene (CAS 1185310-14-8) is a chemical compound with the molecular formula C7H6ClF and a molecular weight of 147.59 g/mol. IUPAC name: 2-chloro-4-fluoro-1-(trideuteriomethyl)benzene. InChIKey: CSARJIQZOSVYHA-FIBGUPNXSA-N.
| Molecular formula | C7H6ClF |
|---|---|
| Molecular weight | 147.59 g/mol |
| IUPAC name | 2-chloro-4-fluoro-1-(trideuteriomethyl)benzene |
| InChIKey | CSARJIQZOSVYHA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C=C(C=C1)F)Cl |
Computed by PubChem (NCBI)