CAS 1185310-16-0 is the registry number for 2–(Methoxy–d3)–4–bromophenol. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-bromo-2-(trideuteriomethoxy)phenol (CAS 1185310-16-0) is a chemical compound with the molecular formula C7H7BrO2 and a molecular weight of 206.05 g/mol. IUPAC name: 4-bromo-2-(trideuteriomethoxy)phenol. InChIKey: WHSIIJQOEGXWSN-FIBGUPNXSA-N.
| Molecular formula | C7H7BrO2 |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | 4-bromo-2-(trideuteriomethoxy)phenol |
| InChIKey | WHSIIJQOEGXWSN-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)Br)O |
Computed by PubChem (NCBI)