CAS 1185310-79-5 is the registry number for 3–Bromo–2–methyl–6–(methyl–d3)–pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
3-bromo-2-methyl-6-(trideuteriomethyl)pyridine (CAS 1185310-79-5) is a chemical compound with the molecular formula C7H8BrN and a molecular weight of 189.07 g/mol. IUPAC name: 3-bromo-2-methyl-6-(trideuteriomethyl)pyridine. InChIKey: TUJVGHCSNXCAFE-FIBGUPNXSA-N.
| Molecular formula | C7H8BrN |
|---|---|
| Molecular weight | 189.07 g/mol |
| IUPAC name | 3-bromo-2-methyl-6-(trideuteriomethyl)pyridine |
| InChIKey | TUJVGHCSNXCAFE-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC(=C(C=C1)Br)C |
Computed by PubChem (NCBI)