CAS 1185311-20-9 is the registry number for 2–Amino–5–(ethyl–d5)–pyridine. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
5-(1,1,2,2,2-pentadeuterioethyl)pyridin-2-amine (CAS 1185311-20-9) is a chemical compound with the molecular formula C7H10N2 and a molecular weight of 127.20 g/mol. IUPAC name: 5-(1,1,2,2,2-pentadeuterioethyl)pyridin-2-amine. InChIKey: OQTNJLQWOVTCPV-ZBJDZAJPSA-N.
| Molecular formula | C7H10N2 |
|---|---|
| Molecular weight | 127.20 g/mol |
| IUPAC name | 5-(1,1,2,2,2-pentadeuterioethyl)pyridin-2-amine |
| InChIKey | OQTNJLQWOVTCPV-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=CN=C(C=C1)N |
Computed by PubChem (NCBI)