Products 1185311-31-2
CAS 1185311-31-2 is the registry number for 2–Bromo–5–(ethyl–d5)–thiophene. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
2-bromo-5-(1,1,2,2,2-pentadeuterioethyl)thiophene (CAS 1185311-31-2) is a chemical compound with the molecular formula C6H7BrS and a molecular weight of 196.12 g/mol. IUPAC name: 2-bromo-5-(1,1,2,2,2-pentadeuterioethyl)thiophene. InChIKey: HYRYQZIGBWDHAD-ZBJDZAJPSA-N.
| Molecular formula | C6H7BrS |
|---|---|
| Molecular weight | 196.12 g/mol |
| IUPAC name | 2-bromo-5-(1,1,2,2,2-pentadeuterioethyl)thiophene |
| InChIKey | HYRYQZIGBWDHAD-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=CC=C(S1)Br |
Computed by PubChem (NCBI)