Products 1185311-40-3
CAS 1185311-40-3 is the registry number for 2–Bromo–5–(n–propyl–d7)–thiophene. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
2-bromo-5-(1,1,2,2,3,3,3-heptadeuteriopropyl)thiophene (CAS 1185311-40-3) is a chemical compound with the molecular formula C7H9BrS and a molecular weight of 212.16 g/mol. IUPAC name: 2-bromo-5-(1,1,2,2,3,3,3-heptadeuteriopropyl)thiophene. InChIKey: AZMSRFANKVHIEG-NCKGIQLSSA-N.
| Molecular formula | C7H9BrS |
|---|---|
| Molecular weight | 212.16 g/mol |
| IUPAC name | 2-bromo-5-(1,1,2,2,3,3,3-heptadeuteriopropyl)thiophene |
| InChIKey | AZMSRFANKVHIEG-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=CC=C(S1)Br |
Computed by PubChem (NCBI)