CAS 1185311-76-5 is the registry number for 2–Hydroxy–5–(iso–propyl–d7)–pyrazine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1H-pyrazin-2-one (CAS 1185311-76-5) is a chemical compound with the molecular formula C7H10N2O and a molecular weight of 145.21 g/mol. IUPAC name: 5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1H-pyrazin-2-one. InChIKey: AYNPNZMHFLWAMH-TXVPSQRDSA-N.
| Molecular formula | C7H10N2O |
|---|---|
| Molecular weight | 145.21 g/mol |
| IUPAC name | 5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1H-pyrazin-2-one |
| InChIKey | AYNPNZMHFLWAMH-TXVPSQRDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=CNC(=O)C=N1)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)