CAS 1185311-78-7 is the registry number for 3,5–(Dimethoxy–d6)–bromobenzene. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
1-bromo-3,5-bis(trideuteriomethoxy)benzene (CAS 1185311-78-7) is a chemical compound with the molecular formula C8H9BrO2 and a molecular weight of 223.10 g/mol. IUPAC name: 1-bromo-3,5-bis(trideuteriomethoxy)benzene. InChIKey: KRWRFIMBWRVMKE-WFGJKAKNSA-N.
| Molecular formula | C8H9BrO2 |
|---|---|
| Molecular weight | 223.10 g/mol |
| IUPAC name | 1-bromo-3,5-bis(trideuteriomethoxy)benzene |
| InChIKey | KRWRFIMBWRVMKE-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=CC(=C1)Br)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)