Products 1185311-82-3
CAS 1185311-82-3 is the registry number for 4–Chloro–2–methylthio–6–(methyl–d3)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-chloro-2-methylsulfanyl-6-(trideuteriomethyl)pyrimidine (CAS 1185311-82-3) is a chemical compound with the molecular formula C6H7ClN2S and a molecular weight of 177.67 g/mol. IUPAC name: 4-chloro-2-methylsulfanyl-6-(trideuteriomethyl)pyrimidine. InChIKey: ALMBOXQFPLQVLF-FIBGUPNXSA-N.
| Molecular formula | C6H7ClN2S |
|---|---|
| Molecular weight | 177.67 g/mol |
| IUPAC name | 4-chloro-2-methylsulfanyl-6-(trideuteriomethyl)pyrimidine |
| InChIKey | ALMBOXQFPLQVLF-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=NC(=N1)SC)Cl |
Computed by PubChem (NCBI)