CAS 1185311-88-9 is the registry number for 2–Bromo–5–(methyl–d3–amino)pyrazine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
5-bromo-N-(trideuteriomethyl)pyrazin-2-amine (CAS 1185311-88-9) is a chemical compound with the molecular formula C5H6BrN3 and a molecular weight of 191.04 g/mol. IUPAC name: 5-bromo-N-(trideuteriomethyl)pyrazin-2-amine. InChIKey: GJVFQZGJWPCJSP-FIBGUPNXSA-N.
| Molecular formula | C5H6BrN3 |
|---|---|
| Molecular weight | 191.04 g/mol |
| IUPAC name | 5-bromo-N-(trideuteriomethyl)pyrazin-2-amine |
| InChIKey | GJVFQZGJWPCJSP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC1=CN=C(C=N1)Br |
Computed by PubChem (NCBI)