Products 1185311-90-3
CAS 1185311-90-3 is the registry number for 4–Chloro–2–methylthio–6–(ethyl–d5)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-chloro-2-methylsulfanyl-6-(1,1,2,2,2-pentadeuterioethyl)pyrimidine (CAS 1185311-90-3) is a chemical compound with the molecular formula C7H9ClN2S and a molecular weight of 193.71 g/mol. IUPAC name: 4-chloro-2-methylsulfanyl-6-(1,1,2,2,2-pentadeuterioethyl)pyrimidine. InChIKey: SZBUHIOXKBYQHF-WNWXXORZSA-N.
| Molecular formula | C7H9ClN2S |
|---|---|
| Molecular weight | 193.71 g/mol |
| IUPAC name | 4-chloro-2-methylsulfanyl-6-(1,1,2,2,2-pentadeuterioethyl)pyrimidine |
| InChIKey | SZBUHIOXKBYQHF-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=CC(=NC(=N1)SC)Cl |
Computed by PubChem (NCBI)