CAS 1185312-02-0 is the registry number for 4–(Methyl–d3)–1,2–dibromobenzene. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
1,2-dibromo-4-(trideuteriomethyl)benzene (CAS 1185312-02-0) is a chemical compound with the molecular formula C7H6Br2 and a molecular weight of 252.95 g/mol. IUPAC name: 1,2-dibromo-4-(trideuteriomethyl)benzene. InChIKey: LDCPXNOCWDGYIU-FIBGUPNXSA-N.
| Molecular formula | C7H6Br2 |
|---|---|
| Molecular weight | 252.95 g/mol |
| IUPAC name | 1,2-dibromo-4-(trideuteriomethyl)benzene |
| InChIKey | LDCPXNOCWDGYIU-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=C(C=C1)Br)Br |
Computed by PubChem (NCBI)