CAS 1185312-29-1 is the registry number for 4–Chloro–5–trifluoromethyl–2–(methyl–d3)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-chloro-2-(trideuteriomethyl)-5-(trifluoromethyl)pyrimidine (CAS 1185312-29-1) is a chemical compound with the molecular formula C6H4ClF3N2 and a molecular weight of 199.57 g/mol. IUPAC name: 4-chloro-2-(trideuteriomethyl)-5-(trifluoromethyl)pyrimidine. InChIKey: IYZXRWKRVDAMAT-FIBGUPNXSA-N.
| Molecular formula | C6H4ClF3N2 |
|---|---|
| Molecular weight | 199.57 g/mol |
| IUPAC name | 4-chloro-2-(trideuteriomethyl)-5-(trifluoromethyl)pyrimidine |
| InChIKey | IYZXRWKRVDAMAT-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC=C(C(=N1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)