Products 1185312-64-4
CAS 1185312-64-4 is the registry number for 3–(Methyl–d3)–5–(methoxy–d3)–bromobenzene. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
1-bromo-3-(trideuteriomethoxy)-5-(trideuteriomethyl)benzene (CAS 1185312-64-4) is a chemical compound with the molecular formula C8H9BrO and a molecular weight of 207.10 g/mol. IUPAC name: 1-bromo-3-(trideuteriomethoxy)-5-(trideuteriomethyl)benzene. InChIKey: AOEVRCZZWJWKPG-WFGJKAKNSA-N.
| Molecular formula | C8H9BrO |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | 1-bromo-3-(trideuteriomethoxy)-5-(trideuteriomethyl)benzene |
| InChIKey | AOEVRCZZWJWKPG-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=CC(=C1)Br)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)