CAS 1185313-11-4 is the registry number for 4–Bromo–2–(iso–propyl–d7–amino)pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-bromo-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyridin-2-amine (CAS 1185313-11-4) is a chemical compound with the molecular formula C8H11BrN2 and a molecular weight of 222.13 g/mol. IUPAC name: 4-bromo-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyridin-2-amine. InChIKey: NTYQEWSDJNVKAY-NWOXSKRJSA-N.
| Molecular formula | C8H11BrN2 |
|---|---|
| Molecular weight | 222.13 g/mol |
| IUPAC name | 4-bromo-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyridin-2-amine |
| InChIKey | NTYQEWSDJNVKAY-NWOXSKRJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC1=NC=CC(=C1)Br |
Computed by PubChem (NCBI)