CAS 1185313-24-9 is the registry number for pyridin–d4–2–ol. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
3,4,5,6-tetradeuterio-1H-pyridin-2-one (CAS 1185313-24-9) is a chemical compound with the molecular formula C5H5NO and a molecular weight of 99.12 g/mol. IUPAC name: 3,4,5,6-tetradeuterio-1H-pyridin-2-one. InChIKey: UBQKCCHYAOITMY-RHQRLBAQSA-N.
| Molecular formula | C5H5NO |
|---|---|
| Molecular weight | 99.12 g/mol |
| IUPAC name | 3,4,5,6-tetradeuterio-1H-pyridin-2-one |
| InChIKey | UBQKCCHYAOITMY-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=O)NC(=C1[2H])[2H])[2H] |
Computed by PubChem (NCBI)