Products 1185313-52-3
CAS 1185313-52-3 is the registry number for 2，4–Dichloro–6–(methoxy–d3)–pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
2,4-dichloro-6-(trideuteriomethoxy)pyridine (CAS 1185313-52-3) is a chemical compound with the molecular formula C6H5Cl2NO and a molecular weight of 181.03 g/mol. IUPAC name: 2,4-dichloro-6-(trideuteriomethoxy)pyridine. InChIKey: DHWHMXYTPKDBSY-FIBGUPNXSA-N.
| Molecular formula | C6H5Cl2NO |
|---|---|
| Molecular weight | 181.03 g/mol |
| IUPAC name | 2,4-dichloro-6-(trideuteriomethoxy)pyridine |
| InChIKey | DHWHMXYTPKDBSY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=NC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)