Products 1185313-61-4
CAS 1185313-61-4 is the registry number for 3–Chloro–4–(ethyl–d5)–1，2，5–thiadiazole. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
3-chloro-4-(1,1,2,2,2-pentadeuterioethyl)-1,2,5-thiadiazole (CAS 1185313-61-4) is a chemical compound with the molecular formula C4H5ClN2S and a molecular weight of 153.65 g/mol. IUPAC name: 3-chloro-4-(1,1,2,2,2-pentadeuterioethyl)-1,2,5-thiadiazole. InChIKey: HCDFDLWINHIMFQ-ZBJDZAJPSA-N.
| Molecular formula | C4H5ClN2S |
|---|---|
| Molecular weight | 153.65 g/mol |
| IUPAC name | 3-chloro-4-(1,1,2,2,2-pentadeuterioethyl)-1,2,5-thiadiazole |
| InChIKey | HCDFDLWINHIMFQ-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=NSN=C1Cl |
Computed by PubChem (NCBI)