CAS 1185313-73-8 is the registry number for 3–Chloro–4–(n–propyl–d7)–1,2,5–thiadiazole. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
3-chloro-4-(1,1,2,2,3,3,3-heptadeuteriopropyl)-1,2,5-thiadiazole (CAS 1185313-73-8) is a chemical compound with the molecular formula C5H7ClN2S and a molecular weight of 169.68 g/mol. IUPAC name: 3-chloro-4-(1,1,2,2,3,3,3-heptadeuteriopropyl)-1,2,5-thiadiazole. InChIKey: KENZJYXFGCDAPO-NCKGIQLSSA-N.
| Molecular formula | C5H7ClN2S |
|---|---|
| Molecular weight | 169.68 g/mol |
| IUPAC name | 3-chloro-4-(1,1,2,2,3,3,3-heptadeuteriopropyl)-1,2,5-thiadiazole |
| InChIKey | KENZJYXFGCDAPO-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=NSN=C1Cl |
Computed by PubChem (NCBI)