CAS 1185313-81-8 is the registry number for 3–Chloro–4–(methoxy–d3)–1,2,5–thiadiazole. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
3-chloro-4-(trideuteriomethoxy)-1,2,5-thiadiazole (CAS 1185313-81-8) is a chemical compound with the molecular formula C3H3ClN2OS and a molecular weight of 153.61 g/mol. IUPAC name: 3-chloro-4-(trideuteriomethoxy)-1,2,5-thiadiazole. InChIKey: SNLDYFHPRJMKLQ-FIBGUPNXSA-N.
| Molecular formula | C3H3ClN2OS |
|---|---|
| Molecular weight | 153.61 g/mol |
| IUPAC name | 3-chloro-4-(trideuteriomethoxy)-1,2,5-thiadiazole |
| InChIKey | SNLDYFHPRJMKLQ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=NSN=C1Cl |
Computed by PubChem (NCBI)