CAS 1185313-96-5 is the registry number for 2–Hydroxy–4–(ethyl–d5)–pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-(1,1,2,2,2-pentadeuterioethyl)-1H-pyridin-2-one (CAS 1185313-96-5) is a chemical compound with the molecular formula C7H9NO and a molecular weight of 128.18 g/mol. IUPAC name: 4-(1,1,2,2,2-pentadeuterioethyl)-1H-pyridin-2-one. InChIKey: XNPOEWPFEMDQDF-ZBJDZAJPSA-N.
| Molecular formula | C7H9NO |
|---|---|
| Molecular weight | 128.18 g/mol |
| IUPAC name | 4-(1,1,2,2,2-pentadeuterioethyl)-1H-pyridin-2-one |
| InChIKey | XNPOEWPFEMDQDF-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=CC(=O)NC=C1 |
Computed by PubChem (NCBI)