Products 1185314-07-1
CAS 1185314-07-1 is the registry number for 3–Acetyl–6–(methyl–d3)–pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
1-[6-(trideuteriomethyl)-3-pyridinyl]ethanone (CAS 1185314-07-1) is a chemical compound with the molecular formula C8H9NO and a molecular weight of 138.18 g/mol. IUPAC name: 1-[6-(trideuteriomethyl)-3-pyridinyl]ethanone. InChIKey: PVRYOKQFLBSILA-FIBGUPNXSA-N.
| Molecular formula | C8H9NO |
|---|---|
| Molecular weight | 138.18 g/mol |
| IUPAC name | 1-[6-(trideuteriomethyl)-3-pyridinyl]ethanone |
| InChIKey | PVRYOKQFLBSILA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC=C(C=C1)C(=O)C |
Computed by PubChem (NCBI)