Products 1185314-09-3
CAS 1185314-09-3 appears in our catalog under these names: 1-Bromo-3-ethylbenzene-d5, 1–bromo–3–(ethyl–d5)benzene. Offered by: MedChemExpress, GLPBio. Available pack sizes: 1 mg, 100mg, 25mg, 5mg.
1-bromo-3-(1,1,2,2,2-pentadeuterioethyl)benzene (CAS 1185314-09-3) is a chemical compound with the molecular formula C8H9Br and a molecular weight of 190.09 g/mol. IUPAC name: 1-bromo-3-(1,1,2,2,2-pentadeuterioethyl)benzene. InChIKey: ZRFJYAZQMFCUIX-ZBJDZAJPSA-N.
| Molecular formula | C8H9Br |
|---|---|
| Molecular weight | 190.09 g/mol |
| IUPAC name | 1-bromo-3-(1,1,2,2,2-pentadeuterioethyl)benzene |
| InChIKey | ZRFJYAZQMFCUIX-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)