Products 1185314-16-2
CAS 1185314-16-2 is the registry number for 3–Bromo–2–(methyl–d3)–pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
3-bromo-2-(trideuteriomethyl)pyridine (CAS 1185314-16-2) is a chemical compound with the molecular formula C6H6BrN and a molecular weight of 175.04 g/mol. IUPAC name: 3-bromo-2-(trideuteriomethyl)pyridine. InChIKey: AIPWPTPHMIYYOX-FIBGUPNXSA-N.
| Molecular formula | C6H6BrN |
|---|---|
| Molecular weight | 175.04 g/mol |
| IUPAC name | 3-bromo-2-(trideuteriomethyl)pyridine |
| InChIKey | AIPWPTPHMIYYOX-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C=CC=N1)Br |
Computed by PubChem (NCBI)