CAS 1185314-28-6 is the registry number for 2,4–Dichloro–6–(ethyl–d5)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
2,4-dichloro-6-(1,1,2,2,2-pentadeuterioethyl)pyrimidine (CAS 1185314-28-6) is a chemical compound with the molecular formula C6H6Cl2N2 and a molecular weight of 182.06 g/mol. IUPAC name: 2,4-dichloro-6-(1,1,2,2,2-pentadeuterioethyl)pyrimidine. InChIKey: ZEGCKSCTOWFFRE-ZBJDZAJPSA-N.
| Molecular formula | C6H6Cl2N2 |
|---|---|
| Molecular weight | 182.06 g/mol |
| IUPAC name | 2,4-dichloro-6-(1,1,2,2,2-pentadeuterioethyl)pyrimidine |
| InChIKey | ZEGCKSCTOWFFRE-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=CC(=NC(=N1)Cl)Cl |
Computed by PubChem (NCBI)