Products 1185314-35-5
CAS 1185314-35-5 is the registry number for 3–Bromo–2–(methoxy–d3)–pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
3-bromo-2-(trideuteriomethoxy)pyridine (CAS 1185314-35-5) is a chemical compound with the molecular formula C6H6BrNO and a molecular weight of 191.04 g/mol. IUPAC name: 3-bromo-2-(trideuteriomethoxy)pyridine. InChIKey: PORGLLGXCAQORO-FIBGUPNXSA-N.
| Molecular formula | C6H6BrNO |
|---|---|
| Molecular weight | 191.04 g/mol |
| IUPAC name | 3-bromo-2-(trideuteriomethoxy)pyridine |
| InChIKey | PORGLLGXCAQORO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC=N1)Br |
Computed by PubChem (NCBI)