CAS 1185314-55-9 is the registry number for 2–Bromo–5–(methyl–d3)–thiophene. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
2-bromo-5-(trideuteriomethyl)thiophene (CAS 1185314-55-9) is a chemical compound with the molecular formula C5H5BrS and a molecular weight of 180.08 g/mol. IUPAC name: 2-bromo-5-(trideuteriomethyl)thiophene. InChIKey: ACDLOOGOFKSUPO-FIBGUPNXSA-N.
| Molecular formula | C5H5BrS |
|---|---|
| Molecular weight | 180.08 g/mol |
| IUPAC name | 2-bromo-5-(trideuteriomethyl)thiophene |
| InChIKey | ACDLOOGOFKSUPO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=C(S1)Br |
Computed by PubChem (NCBI)