CAS 1185314-66-2 is the registry number for 3–Bromo–4–(iso–propyl–d7)–furan. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
3-bromo-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)furan (CAS 1185314-66-2) is a chemical compound with the molecular formula C7H9BrO and a molecular weight of 196.09 g/mol. IUPAC name: 3-bromo-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)furan. InChIKey: CHOXCICECOGAGI-TXVPSQRDSA-N.
| Molecular formula | C7H9BrO |
|---|---|
| Molecular weight | 196.09 g/mol |
| IUPAC name | 3-bromo-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)furan |
| InChIKey | CHOXCICECOGAGI-TXVPSQRDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=COC=C1Br)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)