CAS 1185314-85-5 is the registry number for 4–Chloro–6–methyl–2–(ethyl–d5)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-chloro-6-methyl-2-(1,1,2,2,2-pentadeuterioethyl)pyrimidine (CAS 1185314-85-5) is a chemical compound with the molecular formula C7H9ClN2 and a molecular weight of 161.64 g/mol. IUPAC name: 4-chloro-6-methyl-2-(1,1,2,2,2-pentadeuterioethyl)pyrimidine. InChIKey: UXHUHCFLWOQURB-WNWXXORZSA-N.
| Molecular formula | C7H9ClN2 |
|---|---|
| Molecular weight | 161.64 g/mol |
| IUPAC name | 4-chloro-6-methyl-2-(1,1,2,2,2-pentadeuterioethyl)pyrimidine |
| InChIKey | UXHUHCFLWOQURB-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=NC(=CC(=N1)Cl)C |
Computed by PubChem (NCBI)