Products 1185314-86-6
CAS 1185314-86-6 is the registry number for 2–Chloro–5–(acetyl–d3)–pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
1-(6-chloro-3-pyridinyl)-2,2,2-trideuterioethanone (CAS 1185314-86-6) is a chemical compound with the molecular formula C7H6ClNO and a molecular weight of 158.60 g/mol. IUPAC name: 1-(6-chloro-3-pyridinyl)-2,2,2-trideuterioethanone. InChIKey: UXSNZYGTQTXRAD-FIBGUPNXSA-N.
| Molecular formula | C7H6ClNO |
|---|---|
| Molecular weight | 158.60 g/mol |
| IUPAC name | 1-(6-chloro-3-pyridinyl)-2,2,2-trideuterioethanone |
| InChIKey | UXSNZYGTQTXRAD-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C1=CN=C(C=C1)Cl |
Computed by PubChem (NCBI)