CAS 1185314-99-1 is the registry number for 2–Bromo–5–(acetyl–d3)–furan. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
1-(5-bromofuran-2-yl)-2,2,2-trideuterioethanone (CAS 1185314-99-1) is a chemical compound with the molecular formula C6H5BrO2 and a molecular weight of 192.02 g/mol. IUPAC name: 1-(5-bromofuran-2-yl)-2,2,2-trideuterioethanone. InChIKey: CASNGOWLOZSVMA-FIBGUPNXSA-N.
| Molecular formula | C6H5BrO2 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | 1-(5-bromofuran-2-yl)-2,2,2-trideuterioethanone |
| InChIKey | CASNGOWLOZSVMA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C1=CC=C(O1)Br |
Computed by PubChem (NCBI)