CAS 1185315-18-7 is the registry number for 4–Chloro–6–amino–2–(ethyl–d5)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
6-chloro-2-(1,1,2,2,2-pentadeuterioethyl)pyrimidin-4-amine (CAS 1185315-18-7) is a chemical compound with the molecular formula C6H8ClN3 and a molecular weight of 162.63 g/mol. IUPAC name: 6-chloro-2-(1,1,2,2,2-pentadeuterioethyl)pyrimidin-4-amine. InChIKey: UNSVPHMKJQIBCH-ZBJDZAJPSA-N.
| Molecular formula | C6H8ClN3 |
|---|---|
| Molecular weight | 162.63 g/mol |
| IUPAC name | 6-chloro-2-(1,1,2,2,2-pentadeuterioethyl)pyrimidin-4-amine |
| InChIKey | UNSVPHMKJQIBCH-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=NC(=CC(=N1)Cl)N |
Computed by PubChem (NCBI)