Products 1185315-23-4
CAS 1185315-23-4 is the registry number for 4–Bromo–1，3，5–(trimethyl–d9)–pyrazole. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-bromo-1,3,5-tris(trideuteriomethyl)pyrazole (CAS 1185315-23-4) is a chemical compound with the molecular formula C6H9BrN2 and a molecular weight of 198.11 g/mol. IUPAC name: 4-bromo-1,3,5-tris(trideuteriomethyl)pyrazole. InChIKey: UNTQXOJGXGRHMG-GQALSZNTSA-N.
| Molecular formula | C6H9BrN2 |
|---|---|
| Molecular weight | 198.11 g/mol |
| IUPAC name | 4-bromo-1,3,5-tris(trideuteriomethyl)pyrazole |
| InChIKey | UNTQXOJGXGRHMG-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=NN1C([2H])([2H])[2H])C([2H])([2H])[2H])Br |
Computed by PubChem (NCBI)