CAS 1185315-50-7 is the registry number for 2–Amino–5–(n–propyl–d7)–thiazole. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
5-(1,1,2,2,3,3,3-heptadeuteriopropyl)-1,3-thiazol-2-amine (CAS 1185315-50-7) is a chemical compound with the molecular formula C6H10N2S and a molecular weight of 149.27 g/mol. IUPAC name: 5-(1,1,2,2,3,3,3-heptadeuteriopropyl)-1,3-thiazol-2-amine. InChIKey: WURBKTNKFMMSGZ-NCKGIQLSSA-N.
| Molecular formula | C6H10N2S |
|---|---|
| Molecular weight | 149.27 g/mol |
| IUPAC name | 5-(1,1,2,2,3,3,3-heptadeuteriopropyl)-1,3-thiazol-2-amine |
| InChIKey | WURBKTNKFMMSGZ-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=CN=C(S1)N |
Computed by PubChem (NCBI)