CAS 1185315-62-1 is the registry number for 5–Bromo–2–(methoxy–d3)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
5-bromo-2-(trideuteriomethoxy)pyrimidine (CAS 1185315-62-1) is a chemical compound with the molecular formula C5H5BrN2O and a molecular weight of 192.03 g/mol. IUPAC name: 5-bromo-2-(trideuteriomethoxy)pyrimidine. InChIKey: DWVCZDMMGYIULX-FIBGUPNXSA-N.
| Molecular formula | C5H5BrN2O |
|---|---|
| Molecular weight | 192.03 g/mol |
| IUPAC name | 5-bromo-2-(trideuteriomethoxy)pyrimidine |
| InChIKey | DWVCZDMMGYIULX-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=NC=C(C=N1)Br |
Computed by PubChem (NCBI)