CAS 1185315-83-6 is the registry number for 4–Amino–2–(methyl–d3)–pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
2-(trideuteriomethyl)pyridin-4-amine (CAS 1185315-83-6) is a chemical compound with the molecular formula C6H8N2 and a molecular weight of 111.16 g/mol. IUPAC name: 2-(trideuteriomethyl)pyridin-4-amine. InChIKey: GNCLPNMQEGMNTG-FIBGUPNXSA-N.
| Molecular formula | C6H8N2 |
|---|---|
| Molecular weight | 111.16 g/mol |
| IUPAC name | 2-(trideuteriomethyl)pyridin-4-amine |
| InChIKey | GNCLPNMQEGMNTG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC=CC(=C1)N |
Computed by PubChem (NCBI)